C35H40F6MoN2O2 — CID 144700683
[2,6-di(propan-2-yl)phenyl]imino-(2-methyl-2-phenylpropylidene)molybdenum;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;quinolin-8-ol (PubChem CID 144700683) has the molecular formula C35H40F6MoN2O2 and a molecular weight of 730.65 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]imino-(2-methyl-2-phenylpropylidene)molybdenum;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;quinolin-8-ol.
| Compound Name | [2,6-di(propan-2-yl)phenyl]imino-(2-methyl-2-phenylpropylidene)molybdenum;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;quinolin-8-ol |
|---|---|
| PubChem CID | 144700683 |
| Molecular Formula | C35H40F6MoN2O2 |
| Molecular Weight | 730.65 g/mol |
| Exact Mass | 732.20 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]imino-(2-methyl-2-phenylpropylidene)molybdenum;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;quinolin-8-ol |
| SMILES | CC(C)c1cccc(C(C)C)c1N=[Mo]=CC(C)(C)c1ccccc1.CC(O)(C(F)(F)F)C(F)(F)F.Oc1cccc2cccnc12 |
| InChI | InChI=1S/C12H17N.C10H12.C9H7NO.C4H4F6O.Mo/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;1-10(2,3)9-7-5-4-6-8-9;11-8-5-1-3-7-4-2-6-10-9(7)8;1-2(11,3(5,6)7)4(8,9)10;/h5-9H,1-4H3;1,4-8H,2-3H3;1-6,11H;11H,1H3; |
| InChIKey | GPQQDUQSARSDEF-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.65 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |