C30H36FN3O5S — CID 144701031
tert-butyl (1R,2S,3S,7S)-7-[[(1S)-1-amino-2-[4-(4-ethylsulfonylphenyl)-2-fluorophenyl]ethyl]carbamoyl]-3-methyl-6-azatricyclo[3.2.1.02,4]oct-4-ene-6-carboxylate (PubChem CID 144701031) has the molecular formula C30H36FN3O5S and a molecular weight of 569.70 g/mol. Its IUPAC name is tert-butyl (1R,2S,3S,7S)-7-[[(1S)-1-amino-2-[4-(4-ethylsulfonylphenyl)-2-fluorophenyl]ethyl]carbamoyl]-3-methyl-6-azatricyclo[3.2.1.02,4]oct-4-ene-6-carboxylate.
| Compound Name | tert-butyl (1R,2S,3S,7S)-7-[[(1S)-1-amino-2-[4-(4-ethylsulfonylphenyl)-2-fluorophenyl]ethyl]carbamoyl]-3-methyl-6-azatricyclo[3.2.1.02,4]oct-4-ene-6-carboxylate |
|---|---|
| PubChem CID | 144701031 |
| Molecular Formula | C30H36FN3O5S |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | tert-butyl (1R,2S,3S,7S)-7-[[(1S)-1-amino-2-[4-(4-ethylsulfonylphenyl)-2-fluorophenyl]ethyl]carbamoyl]-3-methyl-6-azatricyclo[3.2.1.02,4]oct-4-ene-6-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc(-c2ccc(C[C@@H](N)NC(=O)[C@@H]3[C@@H]4CC(=C5[C@H]4[C@@H]5C)N3C(=O)OC(C)(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C30H36FN3O5S/c1-6-40(37,38)20-11-9-17(10-12-20)18-7-8-19(22(31)13-18)14-24(32)33-28(35)27-21-15-23(26-16(2)25(21)26)34(27)29(36)39-30(3,4)5/h7-13,16,21,24-25,27H,6,14-15,32H2,1-5H3,(H,33,35)/t16-,21+,24-,25-,27-/m0/s1 |
| InChIKey | NGBBSJKILDXULS-MTRJTAQMSA-N |
| XLogP | 4.39 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|