C26H38FN5O3S — CID 144701199
tert-butyl (1R,3S)-3-(cyanomethylcarbamoyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate;1-(3-fluoro-4-methylphenyl)-4-methylsulfanylpiperazine (PubChem CID 144701199) has the molecular formula C26H38FN5O3S and a molecular weight of 519.69 g/mol. Its IUPAC name is tert-butyl (1R,3S)-3-(cyanomethylcarbamoyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate;1-(3-fluoro-4-methylphenyl)-4-methylsulfanylpiperazine.
| Compound Name | tert-butyl (1R,3S)-3-(cyanomethylcarbamoyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate;1-(3-fluoro-4-methylphenyl)-4-methylsulfanylpiperazine |
|---|---|
| PubChem CID | 144701199 |
| Molecular Formula | C26H38FN5O3S |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | tert-butyl (1R,3S)-3-(cyanomethylcarbamoyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate;1-(3-fluoro-4-methylphenyl)-4-methylsulfanylpiperazine |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CCC(C2)[C@H]1C(=O)NCC#N.CSN1CCN(c2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C14H21N3O3.C12H17FN2S/c1-14(2,3)20-13(19)17-10-5-4-9(8-10)11(17)12(18)16-7-6-15;1-10-3-4-11(9-12(10)13)14-5-7-15(16-2)8-6-14/h9-11H,4-5,7-8H2,1-3H3,(H,16,18);3-4,9H,5-8H2,1-2H3/t9?,10-,11+;/m1./s1 |
| InChIKey | FDNDADUPQSFQKF-LLRQXEEASA-N |
| XLogP | 3.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|