About 6-bromo-1-methylindole-2,3-dione;ethane
6-bromo-1-methylindole-2,3-dione;ethane (PubChem CID 144701236) has the molecular formula C15H24BrNO2
and a molecular weight of 330.27 g/mol. Its IUPAC name is 6-bromo-1-methylindole-2,3-dione;ethane.
Molecular Properties
| Compound Name | 6-bromo-1-methylindole-2,3-dione;ethane |
| PubChem CID | 144701236 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 6-bromo-1-methylindole-2,3-dione;ethane |
| SMILES | CC.CC.CC.CN1C(=O)C(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C9H6BrNO2.3C2H6/c1-11-7-4-5(10)2-3-6(7)8(12)9(11)13;3*1-2/h2-4H,1H3;3*1-2H3 |
| InChIKey | KLHYSQKGFMSGFD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1-methylindole-2,3-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-methylindole-2,3-dione;ethane?
The IUPAC name of 6-bromo-1-methylindole-2,3-dione;ethane (CID 144701236) is 6-bromo-1-methylindole-2,3-dione;ethane.
What is the SMILES notation for 6-bromo-1-methylindole-2,3-dione;ethane?
The canonical SMILES for 6-bromo-1-methylindole-2,3-dione;ethane is CC.CC.CC.CN1C(=O)C(=O)c2ccc(Br)cc21.
What is the InChIKey of 6-bromo-1-methylindole-2,3-dione;ethane?
The InChIKey is KLHYSQKGFMSGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNO2.3C2H6/c1-11-7-4-5(10)2-3-6(7)8(12)9(11)13;3*1-2/h2-4H,1H3;3*1-2H3.
What are the key properties of 6-bromo-1-methylindole-2,3-dione;ethane?
6-bromo-1-methylindole-2,3-dione;ethane has a molecular weight of 330.27 g/mol, XLogP of 4.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-methylindole-2,3-dione;ethane is sourced from PubChem (CID 144701236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).