C15H24BrNO2 — CID 144701236
6-bromo-1-methylindole-2,3-dione;ethane (PubChem CID 144701236) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 6-bromo-1-methylindole-2,3-dione;ethane.
| Compound Name | 6-bromo-1-methylindole-2,3-dione;ethane |
|---|---|
| PubChem CID | 144701236 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 6-bromo-1-methylindole-2,3-dione;ethane |
| SMILES | CC.CC.CC.CN1C(=O)C(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C9H6BrNO2.3C2H6/c1-11-7-4-5(10)2-3-6(7)8(12)9(11)13;3*1-2/h2-4H,1H3;3*1-2H3 |
| InChIKey | KLHYSQKGFMSGFD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|