C21H25FN4O — CID 144701628
1-[(2S)-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-ethyl-6-fluoro-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 144701628) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-[(2S)-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-ethyl-6-fluoro-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-ethyl-6-fluoro-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 144701628 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[(2S)-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-ethyl-6-fluoro-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC[C@H]1C(C)C(Nc2ccc(C3CN3)cn2)c2cc(F)ccc2N1C(C)=O |
| InChI | InChI=1S/C21H25FN4O/c1-4-18-12(2)21(25-20-8-5-14(10-24-20)17-11-23-17)16-9-15(22)6-7-19(16)26(18)13(3)27/h5-10,12,17-18,21,23H,4,11H2,1-3H3,(H,24,25)/t12?,17?,18-,21?/m0/s1 |
| InChIKey | QFMNDRSAGKQJEI-DVJIJSQPSA-N |
| XLogP | 3.80 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|