C17H23N3 — CID 144701693
N-[(2S)-2,3-dimethyl-1-(2-methylphenyl)butyl]pyrimidin-2-amine (PubChem CID 144701693) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[(2S)-2,3-dimethyl-1-(2-methylphenyl)butyl]pyrimidin-2-amine.
| Compound Name | N-[(2S)-2,3-dimethyl-1-(2-methylphenyl)butyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 144701693 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | N-[(2S)-2,3-dimethyl-1-(2-methylphenyl)butyl]pyrimidin-2-amine |
| SMILES | Cc1ccccc1C(Nc1ncccn1)[C@@H](C)C(C)C |
| InChI | InChI=1S/C17H23N3/c1-12(2)14(4)16(15-9-6-5-8-13(15)3)20-17-18-10-7-11-19-17/h5-12,14,16H,1-4H3,(H,18,19,20)/t14-,16?/m0/s1 |
| InChIKey | MJFGMZIEENLTFS-LBAUFKAWSA-N |
| XLogP | 4.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |