About 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde
1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde (PubChem CID 144702272) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde |
| PubChem CID | 144702272 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde |
| SMILES | C#CCOc1ccc(C)c(C)c1.C=CC1CC(=C)CN1C=O |
| InChI | InChI=1S/C11H12O.C8H11NO/c1-4-7-12-11-6-5-9(2)10(3)8-11;1-3-8-4-7(2)5-9(8)6-10/h1,5-6,8H,7H2,2-3H3;3,6,8H,1-2,4-5H2 |
| InChIKey | UZBCYJNCLMWOHF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde?
The IUPAC name of 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde (CID 144702272) is 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde.
What is the SMILES notation for 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde?
The canonical SMILES for 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde is C#CCOc1ccc(C)c(C)c1.C=CC1CC(=C)CN1C=O.
What is the InChIKey of 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde?
The InChIKey is UZBCYJNCLMWOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O.C8H11NO/c1-4-7-12-11-6-5-9(2)10(3)8-11;1-3-8-4-7(2)5-9(8)6-10/h1,5-6,8H,7H2,2-3H3;3,6,8H,1-2,4-5H2.
What are the key properties of 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde?
1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde has a molecular weight of 297.40 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4-prop-2-ynoxybenzene;2-ethenyl-4-methylidenepyrrolidine-1-carbaldehyde is sourced from PubChem (CID 144702272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).