C13H31N3O2 — CID 144702589
N-(2-aminoethyl)-2-(4-methylmorpholin-3-yl)acetamide;ethane (PubChem CID 144702589) has the molecular formula C13H31N3O2 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4-methylmorpholin-3-yl)acetamide;ethane.
| Compound Name | N-(2-aminoethyl)-2-(4-methylmorpholin-3-yl)acetamide;ethane |
|---|---|
| PubChem CID | 144702589 |
| Molecular Formula | C13H31N3O2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.24 |
| IUPAC Name | N-(2-aminoethyl)-2-(4-methylmorpholin-3-yl)acetamide;ethane |
| SMILES | CC.CC.CN1CCOCC1CC(=O)NCCN |
| InChI | InChI=1S/C9H19N3O2.2C2H6/c1-12-4-5-14-7-8(12)6-9(13)11-3-2-10;2*1-2/h8H,2-7,10H2,1H3,(H,11,13);2*1-2H3 |
| InChIKey | MCCNVJNORDUPHV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |