About 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane
5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane (PubChem CID 144702906) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane.
Molecular Properties
| Compound Name | 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane |
| PubChem CID | 144702906 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane |
| SMILES | CCC.CCN1CCc2occc2C1 |
| InChI | InChI=1S/C9H13NO.C3H8/c1-2-10-5-3-9-8(7-10)4-6-11-9;1-3-2/h4,6H,2-3,5,7H2,1H3;3H2,1-2H3 |
| InChIKey | FAVWBORVVNJJBZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane?
The IUPAC name of 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane (CID 144702906) is 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane.
What is the SMILES notation for 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane?
The canonical SMILES for 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane is CCC.CCN1CCc2occc2C1.
What is the InChIKey of 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane?
The InChIKey is FAVWBORVVNJJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C3H8/c1-2-10-5-3-9-8(7-10)4-6-11-9;1-3-2/h4,6H,2-3,5,7H2,1H3;3H2,1-2H3.
What are the key properties of 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane?
5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane has a molecular weight of 195.31 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6,7-dihydro-4H-furo[3,2-c]pyridine;propane is sourced from PubChem (CID 144702906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).