C24H29F4N3O4 — CID 144703334
N-[(Z)-1-amino-5,5,5-trifluoro-3-hydroxy-4,4-dimethylpent-2-enylidene]-2-[4-(5-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetamide;ethane (PubChem CID 144703334) has the molecular formula C24H29F4N3O4 and a molecular weight of 499.51 g/mol. Its IUPAC name is N-[(Z)-1-amino-5,5,5-trifluoro-3-hydroxy-4,4-dimethylpent-2-enylidene]-2-[4-(5-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetamide;ethane.
| Compound Name | N-[(Z)-1-amino-5,5,5-trifluoro-3-hydroxy-4,4-dimethylpent-2-enylidene]-2-[4-(5-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetamide;ethane |
|---|---|
| PubChem CID | 144703334 |
| Molecular Formula | C24H29F4N3O4 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[(Z)-1-amino-5,5,5-trifluoro-3-hydroxy-4,4-dimethylpent-2-enylidene]-2-[4-(5-ethoxy-6-oxo-1H-pyridin-3-yl)-2-fluorophenyl]acetamide;ethane |
| SMILES | CC.CCOc1cc(-c2ccc(CC(=O)/N=C(N)/C=C(\O)C(C)(C)C(F)(F)F)c(F)c2)c[nH]c1=O |
| InChI | InChI=1S/C22H23F4N3O4.C2H6/c1-4-33-16-8-14(11-28-20(16)32)12-5-6-13(15(23)7-12)9-19(31)29-18(27)10-17(30)21(2,3)22(24,25)26;1-2/h5-8,10-11,30H,4,9H2,1-3H3,(H,28,32)(H2,27,29,31);1-2H3/b17-10-; |
| InChIKey | AWYFGTBMMFYJRV-HVHKRRFMSA-N |
| XLogP | 5.06 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|