About ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol
ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol (PubChem CID 144703513) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol |
| PubChem CID | 144703513 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol |
| SMILES | CC.Cc1ccc(C2=CCC3C=CC=CC3=C2O)cc1 |
| InChI | InChI=1S/C17H16O.C2H6/c1-12-6-8-14(9-7-12)16-11-10-13-4-2-3-5-15(13)17(16)18;1-2/h2-9,11,13,18H,10H2,1H3;1-2H3 |
| InChIKey | DMKXVGKOBVAZIJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol?
The IUPAC name of ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol (CID 144703513) is ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol.
What is the SMILES notation for ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol?
The canonical SMILES for ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol is CC.Cc1ccc(C2=CCC3C=CC=CC3=C2O)cc1.
What is the InChIKey of ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol?
The InChIKey is DMKXVGKOBVAZIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O.C2H6/c1-12-6-8-14(9-7-12)16-11-10-13-4-2-3-5-15(13)17(16)18;1-2/h2-9,11,13,18H,10H2,1H3;1-2H3.
What are the key properties of ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol?
ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol has a molecular weight of 266.38 g/mol, XLogP of 5.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-methylphenyl)-4,4a-dihydronaphthalen-1-ol is sourced from PubChem (CID 144703513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).