About (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate
(1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate (PubChem CID 144703705) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate.
Molecular Properties
| Compound Name | (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate |
| PubChem CID | 144703705 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate |
| SMILES | CC(C1=CC=CC(OCC(=O)OC2(C)CCCC2)C1)C(C)(C)C |
| InChI | InChI=1S/C20H32O3/c1-15(19(2,3)4)16-9-8-10-17(13-16)22-14-18(21)23-20(5)11-6-7-12-20/h8-10,15,17H,6-7,11-14H2,1-5H3 |
| InChIKey | FVHZOGPLZCFFGT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate?
The IUPAC name of (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate (CID 144703705) is (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate.
What is the SMILES notation for (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate?
The canonical SMILES for (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate is CC(C1=CC=CC(OCC(=O)OC2(C)CCCC2)C1)C(C)(C)C.
What is the InChIKey of (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate?
The InChIKey is FVHZOGPLZCFFGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O3/c1-15(19(2,3)4)16-9-8-10-17(13-16)22-14-18(21)23-20(5)11-6-7-12-20/h8-10,15,17H,6-7,11-14H2,1-5H3.
What are the key properties of (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate?
(1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate has a molecular weight of 320.47 g/mol, XLogP of 4.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopentyl) 2-[5-(3,3-dimethylbutan-2-yl)cyclohexa-2,4-dien-1-yl]oxyacetate is sourced from PubChem (CID 144703705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).