About 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane
2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane (PubChem CID 144703774) has the molecular formula C13H22F2S3
and a molecular weight of 312.52 g/mol. Its IUPAC name is 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane |
| PubChem CID | 144703774 |
| Molecular Formula | C13H22F2S3 |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane |
| SMILES | CSC(F)(F)C(CC1SCCCS1)C1CCCC1 |
| InChI | InChI=1S/C13H22F2S3/c1-16-13(14,15)11(10-5-2-3-6-10)9-12-17-7-4-8-18-12/h10-12H,2-9H2,1H3 |
| InChIKey | IFWWBMUCHXTOSY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane?
The IUPAC name of 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane (CID 144703774) is 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane.
What is the SMILES notation for 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane?
The canonical SMILES for 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane is CSC(F)(F)C(CC1SCCCS1)C1CCCC1.
What is the InChIKey of 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane?
The InChIKey is IFWWBMUCHXTOSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F2S3/c1-16-13(14,15)11(10-5-2-3-6-10)9-12-17-7-4-8-18-12/h10-12H,2-9H2,1H3.
What are the key properties of 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane?
2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane has a molecular weight of 312.52 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopentyl-3,3-difluoro-3-methylsulfanylpropyl)-1,3-dithiane is sourced from PubChem (CID 144703774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).