methyl (Z)-2-chloro-4-methylpent-2-enoate

C7H11ClO2 — CID 14470393

IUPACmethyl (Z)-2-chloro-4-methylpent-2-enoate
SMILESCOC(=O)/C(Cl)=C/C(C)C
InChIInChI=1S/C7H11ClO2/c1-5(2)4-6(8)7(9)10-3/h4-5H,1-3H3/b6-4-
InChIKeyIPQKICNPACXGOZ-XQRVVYSFSA-N
MW162.62 g/mol
LogP1.94
Rot. Bonds2

About methyl (Z)-2-chloro-4-methylpent-2-enoate

methyl (Z)-2-chloro-4-methylpent-2-enoate (PubChem CID 14470393) has the molecular formula C7H11ClO2 and a molecular weight of 162.62 g/mol. Its IUPAC name is methyl (Z)-2-chloro-4-methylpent-2-enoate.

Molecular Properties

Compound Namemethyl (Z)-2-chloro-4-methylpent-2-enoate
PubChem CID14470393
Molecular FormulaC7H11ClO2
Molecular Weight162.62 g/mol
Exact Mass162.04
IUPAC Namemethyl (Z)-2-chloro-4-methylpent-2-enoate
SMILESCOC(=O)/C(Cl)=C/C(C)C
InChIInChI=1S/C7H11ClO2/c1-5(2)4-6(8)7(9)10-3/h4-5H,1-3H3/b6-4-
InChIKeyIPQKICNPACXGOZ-XQRVVYSFSA-N
XLogP1.94
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.62
LogP ≤ 51.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (Z)-2-chloro-4-methylpent-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-2-chloro-4-methylpent-2-enoate?
The IUPAC name of methyl (Z)-2-chloro-4-methylpent-2-enoate (CID 14470393) is methyl (Z)-2-chloro-4-methylpent-2-enoate.
What is the SMILES notation for methyl (Z)-2-chloro-4-methylpent-2-enoate?
The canonical SMILES for methyl (Z)-2-chloro-4-methylpent-2-enoate is COC(=O)/C(Cl)=C/C(C)C.
What is the InChIKey of methyl (Z)-2-chloro-4-methylpent-2-enoate?
The InChIKey is IPQKICNPACXGOZ-XQRVVYSFSA-N. The full InChI is InChI=1S/C7H11ClO2/c1-5(2)4-6(8)7(9)10-3/h4-5H,1-3H3/b6-4-.
What are the key properties of methyl (Z)-2-chloro-4-methylpent-2-enoate?
methyl (Z)-2-chloro-4-methylpent-2-enoate has a molecular weight of 162.62 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-chloro-4-methylpent-2-enoate is sourced from PubChem (CID 14470393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).