C28H39NO2 — CID 144704028
2-benzyl-1,4-bis(2-methylpropoxy)benzene;(3E,5Z)-hepta-1,3,5-trien-4-amine (PubChem CID 144704028) has the molecular formula C28H39NO2 and a molecular weight of 421.63 g/mol. Its IUPAC name is 2-benzyl-1,4-bis(2-methylpropoxy)benzene;(3E,5Z)-hepta-1,3,5-trien-4-amine.
| Compound Name | 2-benzyl-1,4-bis(2-methylpropoxy)benzene;(3E,5Z)-hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 144704028 |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | 2-benzyl-1,4-bis(2-methylpropoxy)benzene;(3E,5Z)-hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C=C/C.CC(C)COc1ccc(OCC(C)C)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H28O2.C7H11N/c1-16(2)14-22-20-10-11-21(23-15-17(3)4)19(13-20)12-18-8-6-5-7-9-18;1-3-5-7(8)6-4-2/h5-11,13,16-17H,12,14-15H2,1-4H3;3-6H,1,8H2,2H3/b;6-4-,7-5+ |
| InChIKey | UNDGVGFRKNOIAY-HUESEEFGSA-N |
| XLogP | 6.94 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|