C29H33NO2 — CID 144704032
2-[2-methoxy-5-(2,2,4-trimethylpentoxy)phenyl]-N,2-diphenylethenimine (PubChem CID 144704032) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 2-[2-methoxy-5-(2,2,4-trimethylpentoxy)phenyl]-N,2-diphenylethenimine.
| Compound Name | 2-[2-methoxy-5-(2,2,4-trimethylpentoxy)phenyl]-N,2-diphenylethenimine |
|---|---|
| PubChem CID | 144704032 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-[2-methoxy-5-(2,2,4-trimethylpentoxy)phenyl]-N,2-diphenylethenimine |
| SMILES | COc1ccc(OCC(C)(C)CC(C)C)cc1C(=C=Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO2/c1-22(2)19-29(3,4)21-32-25-16-17-28(31-5)26(18-25)27(23-12-8-6-9-13-23)20-30-24-14-10-7-11-15-24/h6-18,22H,19,21H2,1-5H3 |
| InChIKey | KNMQEBLMFLJPTP-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|