C45H36F6N2O2 — CID 144704048
aniline;2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenylethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine (PubChem CID 144704048) has the molecular formula C45H36F6N2O2 and a molecular weight of 750.78 g/mol. Its IUPAC name is aniline;2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenylethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine.
| Compound Name | aniline;2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenylethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine |
|---|---|
| PubChem CID | 144704048 |
| Molecular Formula | C45H36F6N2O2 |
| Molecular Weight | 750.78 g/mol |
| Exact Mass | 750.27 |
| IUPAC Name | aniline;2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenylethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine |
| SMILES | C=C(c1ccccc1)c1cc(C(c2ccc(OC)c(C(=C=Nc3ccccc3)c3ccccc3)c2)(C(F)(F)F)C(F)(F)F)ccc1OC.Nc1ccccc1 |
| InChI | InChI=1S/C39H29F6NO2.C6H7N/c1-26(27-13-7-4-8-14-27)32-23-29(19-21-35(32)47-2)37(38(40,41)42,39(43,44)45)30-20-22-36(48-3)33(24-30)34(28-15-9-5-10-16-28)25-46-31-17-11-6-12-18-31;7-6-4-2-1-3-5-6/h4-24H,1H2,2-3H3;1-5H,7H2 |
| InChIKey | UWEHHLIOQXVGRG-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.78 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|