C17H30FNO — CID 144704334
(1E,3Z,5E)-8-(dipropylamino)-4-ethyl-5-fluoro-6-methylocta-1,3,5-trien-1-ol (PubChem CID 144704334) has the molecular formula C17H30FNO and a molecular weight of 283.43 g/mol. Its IUPAC name is (1E,3Z,5E)-8-(dipropylamino)-4-ethyl-5-fluoro-6-methylocta-1,3,5-trien-1-ol.
| Compound Name | (1E,3Z,5E)-8-(dipropylamino)-4-ethyl-5-fluoro-6-methylocta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 144704334 |
| Molecular Formula | C17H30FNO |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (1E,3Z,5E)-8-(dipropylamino)-4-ethyl-5-fluoro-6-methylocta-1,3,5-trien-1-ol |
| SMILES | CCCN(CCC)CC/C(C)=C(F)\C(=C/C=C/O)CC |
| InChI | InChI=1S/C17H30FNO/c1-5-11-19(12-6-2)13-10-15(4)17(18)16(7-3)9-8-14-20/h8-9,14,20H,5-7,10-13H2,1-4H3/b14-8+,16-9-,17-15+ |
| InChIKey | MLHLMPPHCCJJMM-OSDHNYNUSA-N |
| XLogP | 5.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|