C23H40 — CID 144704495
1-butan-2-yl-4-(3-methylbut-1-ynyl)benzene;2,3-dimethylbutane;ethane (PubChem CID 144704495) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is 1-butan-2-yl-4-(3-methylbut-1-ynyl)benzene;2,3-dimethylbutane;ethane.
| Compound Name | 1-butan-2-yl-4-(3-methylbut-1-ynyl)benzene;2,3-dimethylbutane;ethane |
|---|---|
| PubChem CID | 144704495 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | 1-butan-2-yl-4-(3-methylbut-1-ynyl)benzene;2,3-dimethylbutane;ethane |
| SMILES | CC.CC(C)C(C)C.CCC(C)c1ccc(C#CC(C)C)cc1 |
| InChI | InChI=1S/C15H20.C6H14.C2H6/c1-5-13(4)15-10-8-14(9-11-15)7-6-12(2)3;1-5(2)6(3)4;1-2/h8-13H,5H2,1-4H3;5-6H,1-4H3;1-2H3 |
| InChIKey | HIGDEADRQVLXJL-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|