C8H5Cl2FO2 — CID 144704595
fluoro 2-(2,4-dichlorophenyl)acetate (PubChem CID 144704595) has the molecular formula C8H5Cl2FO2 and a molecular weight of 223.03 g/mol. Its IUPAC name is fluoro 2-(2,4-dichlorophenyl)acetate.
| Compound Name | fluoro 2-(2,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 144704595 |
| Molecular Formula | C8H5Cl2FO2 |
| Molecular Weight | 223.03 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | fluoro 2-(2,4-dichlorophenyl)acetate |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)OF |
| InChI | InChI=1S/C8H5Cl2FO2/c9-6-2-1-5(7(10)4-6)3-8(12)13-11/h1-2,4H,3H2 |
| InChIKey | SVVTZPORFGLYGT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.03 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |