About tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate
tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 14470565) has the molecular formula C35H39NO2P2
and a molecular weight of 567.65 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 14470565 |
| Molecular Formula | C35H39NO2P2 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CP(c2ccccc2)c2ccccc2)C[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H39NO2P2/c1-35(2,3)38-34(37)36-25-28(26-39(30-16-8-4-9-17-30)31-18-10-5-11-19-31)24-29(36)27-40(32-20-12-6-13-21-32)33-22-14-7-15-23-33/h4-23,28-29H,24-27H2,1-3H3/t28-,29-/m0/s1 |
| InChIKey | OGPDLIRXKOHAEP-VMPREFPWSA-N |
| XLogP | 6.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate (CID 14470565) is tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@@H](CP(c2ccccc2)c2ccccc2)C[C@H]1CP(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate?
The InChIKey is OGPDLIRXKOHAEP-VMPREFPWSA-N. The full InChI is InChI=1S/C35H39NO2P2/c1-35(2,3)38-34(37)36-25-28(26-39(30-16-8-4-9-17-30)31-18-10-5-11-19-31)24-29(36)27-40(32-20-12-6-13-21-32)33-22-14-7-15-23-33/h4-23,28-29H,24-27H2,1-3H3/t28-,29-/m0/s1.
What are the key properties of tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate?
tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate has a molecular weight of 567.65 g/mol, XLogP of 6.88, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4S)-2,4-bis(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 14470565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).