About ethane;methanol;1-methyl-3-(3-methylbutyl)benzene
ethane;methanol;1-methyl-3-(3-methylbutyl)benzene (PubChem CID 144705800) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;methanol;1-methyl-3-(3-methylbutyl)benzene.
Molecular Properties
| Compound Name | ethane;methanol;1-methyl-3-(3-methylbutyl)benzene |
| PubChem CID | 144705800 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | ethane;methanol;1-methyl-3-(3-methylbutyl)benzene |
| SMILES | CC.CO.Cc1cccc(CCC(C)C)c1 |
| InChI | InChI=1S/C12H18.C2H6.CH4O/c1-10(2)7-8-12-6-4-5-11(3)9-12;2*1-2/h4-6,9-10H,7-8H2,1-3H3;1-2H3;2H,1H3 |
| InChIKey | QRZRLAQXVMJQRW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methanol;1-methyl-3-(3-methylbutyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;1-methyl-3-(3-methylbutyl)benzene?
The IUPAC name of ethane;methanol;1-methyl-3-(3-methylbutyl)benzene (CID 144705800) is ethane;methanol;1-methyl-3-(3-methylbutyl)benzene.
What is the SMILES notation for ethane;methanol;1-methyl-3-(3-methylbutyl)benzene?
The canonical SMILES for ethane;methanol;1-methyl-3-(3-methylbutyl)benzene is CC.CO.Cc1cccc(CCC(C)C)c1.
What is the InChIKey of ethane;methanol;1-methyl-3-(3-methylbutyl)benzene?
The InChIKey is QRZRLAQXVMJQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C2H6.CH4O/c1-10(2)7-8-12-6-4-5-11(3)9-12;2*1-2/h4-6,9-10H,7-8H2,1-3H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;1-methyl-3-(3-methylbutyl)benzene?
ethane;methanol;1-methyl-3-(3-methylbutyl)benzene has a molecular weight of 224.39 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;1-methyl-3-(3-methylbutyl)benzene is sourced from PubChem (CID 144705800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).