C18H35N — CID 144706313
(3E)-3-ethylidene-3a-methyl-6-pentan-2-yl-2,4,5,6,7,7a-hexahydro-1H-indene;methanamine (PubChem CID 144706313) has the molecular formula C18H35N and a molecular weight of 265.49 g/mol. Its IUPAC name is (3E)-3-ethylidene-3a-methyl-6-pentan-2-yl-2,4,5,6,7,7a-hexahydro-1H-indene;methanamine.
| Compound Name | (3E)-3-ethylidene-3a-methyl-6-pentan-2-yl-2,4,5,6,7,7a-hexahydro-1H-indene;methanamine |
|---|---|
| PubChem CID | 144706313 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (3E)-3-ethylidene-3a-methyl-6-pentan-2-yl-2,4,5,6,7,7a-hexahydro-1H-indene;methanamine |
| SMILES | C/C=C1\CCC2CC(C(C)CCC)CCC12C.CN |
| InChI | InChI=1S/C17H30.CH5N/c1-5-7-13(3)14-10-11-17(4)15(6-2)8-9-16(17)12-14;1-2/h6,13-14,16H,5,7-12H2,1-4H3;2H2,1H3/b15-6+; |
| InChIKey | BTQPXVJNDWQNII-AWXXIEIHSA-N |
| XLogP | 5.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|