C27H25N7O2S — CID 144706569
ethyl 2-[[5-[5-phenyl-4-(pyridin-2-ylmethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-3-pyridinyl]sulfanylamino]acetate (PubChem CID 144706569) has the molecular formula C27H25N7O2S and a molecular weight of 511.61 g/mol. Its IUPAC name is ethyl 2-[[5-[5-phenyl-4-(pyridin-2-ylmethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-3-pyridinyl]sulfanylamino]acetate.
| Compound Name | ethyl 2-[[5-[5-phenyl-4-(pyridin-2-ylmethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-3-pyridinyl]sulfanylamino]acetate |
|---|---|
| PubChem CID | 144706569 |
| Molecular Formula | C27H25N7O2S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | ethyl 2-[[5-[5-phenyl-4-(pyridin-2-ylmethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-3-pyridinyl]sulfanylamino]acetate |
| SMILES | CCOC(=O)CNSc1cncc(-c2nc(NCc3ccccn3)c3c(-c4ccccc4)ccn3n2)c1 |
| InChI | InChI=1S/C27H25N7O2S/c1-2-36-24(35)18-31-37-22-14-20(15-28-17-22)26-32-27(30-16-21-10-6-7-12-29-21)25-23(11-13-34(25)33-26)19-8-4-3-5-9-19/h3-15,17,31H,2,16,18H2,1H3,(H,30,32,33) |
| InChIKey | LEAIOEAETNYJIQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|