C26H30N4O4 — CID 144707260
7-benzyl-3-tert-butyl-1-(3-hydroxypropyl)-8-(2-methylphenoxy)purine-2,6-dione (PubChem CID 144707260) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 7-benzyl-3-tert-butyl-1-(3-hydroxypropyl)-8-(2-methylphenoxy)purine-2,6-dione.
| Compound Name | 7-benzyl-3-tert-butyl-1-(3-hydroxypropyl)-8-(2-methylphenoxy)purine-2,6-dione |
|---|---|
| PubChem CID | 144707260 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 7-benzyl-3-tert-butyl-1-(3-hydroxypropyl)-8-(2-methylphenoxy)purine-2,6-dione |
| SMILES | Cc1ccccc1Oc1nc2c(c(=O)n(CCCO)c(=O)n2C(C)(C)C)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H30N4O4/c1-18-11-8-9-14-20(18)34-24-27-22-21(29(24)17-19-12-6-5-7-13-19)23(32)28(15-10-16-31)25(33)30(22)26(2,3)4/h5-9,11-14,31H,10,15-17H2,1-4H3 |
| InChIKey | YCFYCULWOYMEND-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |