C10H13F3O2 — CID 144707366
(4Z,6Z)-4-ethenyl-7-(trifluoromethoxy)hepta-4,6-dien-1-ol (PubChem CID 144707366) has the molecular formula C10H13F3O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is (4Z,6Z)-4-ethenyl-7-(trifluoromethoxy)hepta-4,6-dien-1-ol.
| Compound Name | (4Z,6Z)-4-ethenyl-7-(trifluoromethoxy)hepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 144707366 |
| Molecular Formula | C10H13F3O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (4Z,6Z)-4-ethenyl-7-(trifluoromethoxy)hepta-4,6-dien-1-ol |
| SMILES | C=C/C(=C\C=C/OC(F)(F)F)CCCO |
| InChI | InChI=1S/C10H13F3O2/c1-2-9(5-3-7-14)6-4-8-15-10(11,12)13/h2,4,6,8,14H,1,3,5,7H2/b8-4-,9-6+ |
| InChIKey | QWOZJALQPGVGIH-NDFHIPMUSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|