C19H21Cl2N5O2 — CID 144707820
5-chloro-2-[2-chloro-5-[3-(methylamino)propoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-amine (PubChem CID 144707820) has the molecular formula C19H21Cl2N5O2 and a molecular weight of 422.32 g/mol. Its IUPAC name is 5-chloro-2-[2-chloro-5-[3-(methylamino)propoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-amine.
| Compound Name | 5-chloro-2-[2-chloro-5-[3-(methylamino)propoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 144707820 |
| Molecular Formula | C19H21Cl2N5O2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 5-chloro-2-[2-chloro-5-[3-(methylamino)propoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-amine |
| SMILES | CNCCCOc1ccc(Cl)c(-c2nc(N)c(Cl)c(-c3c(C)noc3C)n2)c1 |
| InChI | InChI=1S/C19H21Cl2N5O2/c1-10-15(11(2)28-26-10)17-16(21)18(22)25-19(24-17)13-9-12(5-6-14(13)20)27-8-4-7-23-3/h5-6,9,23H,4,7-8H2,1-3H3,(H2,22,24,25) |
| InChIKey | PLRIWURJTUVBAO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|