C35H55BN2O5 — CID 144708354
N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-3-methoxy-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide;propane (PubChem CID 144708354) has the molecular formula C35H55BN2O5 and a molecular weight of 594.65 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-3-methoxy-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide;propane.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-3-methoxy-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide;propane |
|---|---|
| PubChem CID | 144708354 |
| Molecular Formula | C35H55BN2O5 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.42 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-3-methoxy-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide;propane |
| SMILES | CCC.COc1c(CCCB2OC(C)(C)C(C)(C)O2)ccc(C(=O)NN(CC(C)(C)C)C(=O)c2cc(C)cc(C)c2)c1C |
| InChI | InChI=1S/C32H47BN2O5.C3H8/c1-21-17-22(2)19-25(18-21)29(37)35(20-30(4,5)6)34-28(36)26-15-14-24(27(38-11)23(26)3)13-12-16-33-39-31(7,8)32(9,10)40-33;1-3-2/h14-15,17-19H,12-13,16,20H2,1-11H3,(H,34,36);3H2,1-2H3 |
| InChIKey | PCRAQIDDEQAMHS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|