C25H33N3O3 — CID 144708369
N'-(1-amino-2,2-dimethylpropyl)-N'-(3,5-dimethylbenzoyl)-3-hydroxy-2-methyl-4-prop-2-enylbenzohydrazide (PubChem CID 144708369) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N'-(1-amino-2,2-dimethylpropyl)-N'-(3,5-dimethylbenzoyl)-3-hydroxy-2-methyl-4-prop-2-enylbenzohydrazide.
| Compound Name | N'-(1-amino-2,2-dimethylpropyl)-N'-(3,5-dimethylbenzoyl)-3-hydroxy-2-methyl-4-prop-2-enylbenzohydrazide |
|---|---|
| PubChem CID | 144708369 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N'-(1-amino-2,2-dimethylpropyl)-N'-(3,5-dimethylbenzoyl)-3-hydroxy-2-methyl-4-prop-2-enylbenzohydrazide |
| SMILES | C=CCc1ccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(N)C(C)(C)C)c(C)c1O |
| InChI | InChI=1S/C25H33N3O3/c1-8-9-18-10-11-20(17(4)21(18)29)22(30)27-28(24(26)25(5,6)7)23(31)19-13-15(2)12-16(3)14-19/h8,10-14,24,29H,1,9,26H2,2-7H3,(H,27,30) |
| InChIKey | MESJSEDPZLZQDG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|