C22H33F2NO3 — CID 144708596
methyl 7-[3,3-difluoro-5-[(E)-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 144708596) has the molecular formula C22H33F2NO3 and a molecular weight of 397.51 g/mol. Its IUPAC name is methyl 7-[3,3-difluoro-5-[(E)-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[3,3-difluoro-5-[(E)-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 144708596 |
| Molecular Formula | C22H33F2NO3 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | methyl 7-[3,3-difluoro-5-[(E)-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CCC(C)C/C=C/C1CC(F)(F)C(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H33F2NO3/c1-4-5-8-12-18(2)13-11-14-19-17-22(23,24)21(27)25(19)16-10-7-6-9-15-20(26)28-3/h11,14,18-19H,4,6-7,9-10,12-13,15-17H2,1-3H3/b14-11+ |
| InChIKey | BPLMIZVSEIVQJN-SDNWHVSQSA-N |
| XLogP | 4.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|