C7H14O4 — CID 14470922
2-(2,2-dimethoxyethyl)-1,3-dioxolane (PubChem CID 14470922) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-1,3-dioxolane.
| Compound Name | 2-(2,2-dimethoxyethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 14470922 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-1,3-dioxolane |
| SMILES | COC(CC1OCCO1)OC |
| InChI | InChI=1S/C7H14O4/c1-8-6(9-2)5-7-10-3-4-11-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | GNZNSALDFUKYDI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|