C18H27N3O2S — CID 144710311
N-[(1S)-2-(4-aminophenyl)-1-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]acetamide;ethane;formaldehyde (PubChem CID 144710311) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[(1S)-2-(4-aminophenyl)-1-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]acetamide;ethane;formaldehyde.
| Compound Name | N-[(1S)-2-(4-aminophenyl)-1-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]acetamide;ethane;formaldehyde |
|---|---|
| PubChem CID | 144710311 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[(1S)-2-(4-aminophenyl)-1-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]acetamide;ethane;formaldehyde |
| SMILES | C=O.CC.CC(=O)N[C@@H](Cc1ccc(N)cc1)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C15H19N3OS.C2H6.CH2O/c1-9-10(2)20-15(17-9)14(18-11(3)19)8-12-4-6-13(16)7-5-12;2*1-2/h4-7,14H,8,16H2,1-3H3,(H,18,19);1-2H3;1H2/t14-;;/m0../s1 |
| InChIKey | MOPBDNMQLZIFKJ-UTLKBRERSA-N |
| XLogP | 3.60 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|