C16H24N4O — CID 144710536
ethane;(2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 144710536) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is ethane;(2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | ethane;(2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 144710536 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | ethane;(2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CC.Cc1nc2ccc(C(=O)N3CCN(C)CC3)cc2[nH]1 |
| InChI | InChI=1S/C14H18N4O.C2H6/c1-10-15-12-4-3-11(9-13(12)16-10)14(19)18-7-5-17(2)6-8-18;1-2/h3-4,9H,5-8H2,1-2H3,(H,15,16);1-2H3 |
| InChIKey | LGILWIOWUFOYCQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |