C18H20N2O2 — CID 144710557
2,3,5-trimethyl-6-[2-(8-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 144710557) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-[2-(8-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-[2-(8-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 144710557 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2,3,5-trimethyl-6-[2-(8-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCn2c3ccccc3n2C)=C(C)C1=O |
| InChI | InChI=1S/C18H20N2O2/c1-11-12(2)18(22)14(13(3)17(11)21)9-10-20-16-8-6-5-7-15(16)19(20)4/h5-8H,9-10H2,1-4H3 |
| InChIKey | NNMKDBLPVAYZJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|