About ethane;5-propan-2-yl-1,3-benzothiazole
ethane;5-propan-2-yl-1,3-benzothiazole (PubChem CID 144711218) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is ethane;5-propan-2-yl-1,3-benzothiazole.
Molecular Properties
| Compound Name | ethane;5-propan-2-yl-1,3-benzothiazole |
| PubChem CID | 144711218 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | ethane;5-propan-2-yl-1,3-benzothiazole |
| SMILES | CC.CC(C)c1ccc2scnc2c1 |
| InChI | InChI=1S/C10H11NS.C2H6/c1-7(2)8-3-4-10-9(5-8)11-6-12-10;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | LJAVQKVETIPAOZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-propan-2-yl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-propan-2-yl-1,3-benzothiazole?
The IUPAC name of ethane;5-propan-2-yl-1,3-benzothiazole (CID 144711218) is ethane;5-propan-2-yl-1,3-benzothiazole.
What is the SMILES notation for ethane;5-propan-2-yl-1,3-benzothiazole?
The canonical SMILES for ethane;5-propan-2-yl-1,3-benzothiazole is CC.CC(C)c1ccc2scnc2c1.
What is the InChIKey of ethane;5-propan-2-yl-1,3-benzothiazole?
The InChIKey is LJAVQKVETIPAOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS.C2H6/c1-7(2)8-3-4-10-9(5-8)11-6-12-10;1-2/h3-7H,1-2H3;1-2H3.
What are the key properties of ethane;5-propan-2-yl-1,3-benzothiazole?
ethane;5-propan-2-yl-1,3-benzothiazole has a molecular weight of 207.34 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-propan-2-yl-1,3-benzothiazole is sourced from PubChem (CID 144711218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).