C24H33N4O5S+ — CID 144711597
CID 144711597 (PubChem CID 144711597) has the molecular formula C24H33N4O5S+ and a molecular weight of 489.62 g/mol.
| Compound Name | CID 144711597 |
|---|---|
| PubChem CID | 144711597 |
| Molecular Formula | C24H33N4O5S+ |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | — |
| SMILES | C1COCCN1.CC(=O)N1CCN(Cc2ccc(C(=O)Nc3ccc([SH+](=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H23N3O4S.C4H9NO/c1-15(24)23-12-10-22(11-13-23)14-16-2-4-17(5-3-16)20(25)21-18-6-8-19(9-7-18)28(26)27;1-3-6-4-2-5-1/h2-9H,10-14H2,1H3,(H,21,25)(H,26,27);5H,1-4H2/p+1 |
| InChIKey | OLXSSIUDGDURPG-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|