C31H36ClN3OS2 — CID 144711601
2-(4-chlorophenyl)-N-[5-methyl-4-[1-(2-methylphenyl)sulfanyl-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]acetamide;ethane (PubChem CID 144711601) has the molecular formula C31H36ClN3OS2 and a molecular weight of 566.24 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[5-methyl-4-[1-(2-methylphenyl)sulfanyl-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]acetamide;ethane.
| Compound Name | 2-(4-chlorophenyl)-N-[5-methyl-4-[1-(2-methylphenyl)sulfanyl-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]acetamide;ethane |
|---|---|
| PubChem CID | 144711601 |
| Molecular Formula | C31H36ClN3OS2 |
| Molecular Weight | 566.24 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[5-methyl-4-[1-(2-methylphenyl)sulfanyl-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]acetamide;ethane |
| SMILES | CC.CC.Cc1ccccc1SN1CCc2cc(-c3nc(NC(=O)Cc4ccc(Cl)cc4)sc3C)ccc21 |
| InChI | InChI=1S/C27H24ClN3OS2.2C2H6/c1-17-5-3-4-6-24(17)34-31-14-13-20-16-21(9-12-23(20)31)26-18(2)33-27(30-26)29-25(32)15-19-7-10-22(28)11-8-19;2*1-2/h3-12,16H,13-15H2,1-2H3,(H,29,30,32);2*1-2H3 |
| InChIKey | XPXMEEXNQBNDFJ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.24 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|