C26H31N3OS — CID 144711618
N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide (PubChem CID 144711618) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide.
| Compound Name | N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 144711618 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide |
| SMILES | CCN(C)Sc1ccc(NC(=O)c2ccc(CN3CCC4=C(C=CCC4)C3)cc2)cc1 |
| InChI | InChI=1S/C26H31N3OS/c1-3-28(2)31-25-14-12-24(13-15-25)27-26(30)22-10-8-20(9-11-22)18-29-17-16-21-6-4-5-7-23(21)19-29/h5,7-15H,3-4,6,16-19H2,1-2H3,(H,27,30) |
| InChIKey | ICYBHVXIZDTANA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|