C27H33N3O2S — CID 144711762
formamide;4-[3-[4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanylmorpholine (PubChem CID 144711762) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is formamide;4-[3-[4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanylmorpholine.
| Compound Name | formamide;4-[3-[4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanylmorpholine |
|---|---|
| PubChem CID | 144711762 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | formamide;4-[3-[4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanylmorpholine |
| SMILES | C1=CC2=C(CC1)CCN(Cc1ccc(-c3cccc(SN4CCOCC4)c3)cc1)C2.NC=O |
| InChI | InChI=1S/C26H30N2OS.CH3NO/c1-2-5-25-20-27(13-12-22(25)4-1)19-21-8-10-23(11-9-21)24-6-3-7-26(18-24)30-28-14-16-29-17-15-28;2-1-3/h2-3,5-11,18H,1,4,12-17,19-20H2;1H,(H2,2,3) |
| InChIKey | OUNMQTOFMICWGO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|