About 2-cyclopropyl-N,N-dimethylbenzamide
2-cyclopropyl-N,N-dimethylbenzamide (PubChem CID 144712792) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-cyclopropyl-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N,N-dimethylbenzamide |
| PubChem CID | 144712792 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-cyclopropyl-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1C1CC1 |
| InChI | InChI=1S/C12H15NO/c1-13(2)12(14)11-6-4-3-5-10(11)9-7-8-9/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | ODHBZTVXHYVPLH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N,N-dimethylbenzamide?
The IUPAC name of 2-cyclopropyl-N,N-dimethylbenzamide (CID 144712792) is 2-cyclopropyl-N,N-dimethylbenzamide.
What is the SMILES notation for 2-cyclopropyl-N,N-dimethylbenzamide?
The canonical SMILES for 2-cyclopropyl-N,N-dimethylbenzamide is CN(C)C(=O)c1ccccc1C1CC1.
What is the InChIKey of 2-cyclopropyl-N,N-dimethylbenzamide?
The InChIKey is ODHBZTVXHYVPLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-13(2)12(14)11-6-4-3-5-10(11)9-7-8-9/h3-6,9H,7-8H2,1-2H3.
What are the key properties of 2-cyclopropyl-N,N-dimethylbenzamide?
2-cyclopropyl-N,N-dimethylbenzamide has a molecular weight of 189.26 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N,N-dimethylbenzamide is sourced from PubChem (CID 144712792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).