C25H34N6O — CID 144713176
4-(cyclohexylamino)-N'-[2-(2-methylpropyl)-1,3-dihydroisoindol-5-yl]-2-oxo-1H-pyridine-3-carboximidamide;formonitrile (PubChem CID 144713176) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is 4-(cyclohexylamino)-N'-[2-(2-methylpropyl)-1,3-dihydroisoindol-5-yl]-2-oxo-1H-pyridine-3-carboximidamide;formonitrile.
| Compound Name | 4-(cyclohexylamino)-N'-[2-(2-methylpropyl)-1,3-dihydroisoindol-5-yl]-2-oxo-1H-pyridine-3-carboximidamide;formonitrile |
|---|---|
| PubChem CID | 144713176 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 4-(cyclohexylamino)-N'-[2-(2-methylpropyl)-1,3-dihydroisoindol-5-yl]-2-oxo-1H-pyridine-3-carboximidamide;formonitrile |
| SMILES | C#N.CC(C)CN1Cc2ccc(/N=C(\N)c3c(NC4CCCCC4)cc[nH]c3=O)cc2C1 |
| InChI | InChI=1S/C24H33N5O.CHN/c1-16(2)13-29-14-17-8-9-20(12-18(17)15-29)28-23(25)22-21(10-11-26-24(22)30)27-19-6-4-3-5-7-19;1-2/h8-12,16,19H,3-7,13-15H2,1-2H3,(H2,25,28)(H2,26,27,30);1H |
| InChIKey | YZSSLACUPXJNER-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|