C38H25N3 — CID 144713821
2-carbazol-9-yl-4-[(3E)-hexa-1,3,5-trien-3-yl]-5,6-diphenylbenzene-1,3-dicarbonitrile (PubChem CID 144713821) has the molecular formula C38H25N3 and a molecular weight of 523.64 g/mol. Its IUPAC name is 2-carbazol-9-yl-4-[(3E)-hexa-1,3,5-trien-3-yl]-5,6-diphenylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-carbazol-9-yl-4-[(3E)-hexa-1,3,5-trien-3-yl]-5,6-diphenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 144713821 |
| Molecular Formula | C38H25N3 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-carbazol-9-yl-4-[(3E)-hexa-1,3,5-trien-3-yl]-5,6-diphenylbenzene-1,3-dicarbonitrile |
| SMILES | C=C/C=C(\C=C)c1c(C#N)c(-n2c3ccccc3c3ccccc32)c(C#N)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C38H25N3/c1-3-15-26(4-2)35-31(24-39)38(41-33-22-13-11-20-29(33)30-21-12-14-23-34(30)41)32(25-40)36(27-16-7-5-8-17-27)37(35)28-18-9-6-10-19-28/h3-23H,1-2H2/b26-15+ |
| InChIKey | JNIDSAIVEBRMRO-CVKSISIWSA-N |
| XLogP | 9.62 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|