About 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane
5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane (PubChem CID 144713865) has the molecular formula C18H17FN2
and a molecular weight of 280.35 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane.
Molecular Properties
| Compound Name | 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane |
| PubChem CID | 144713865 |
| Molecular Formula | C18H17FN2 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane |
| SMILES | CC.Cc1cccc(C)c1-c1cc(C#N)c(F)c(C#N)c1 |
| InChI | InChI=1S/C16H11FN2.C2H6/c1-10-4-3-5-11(2)15(10)12-6-13(8-18)16(17)14(7-12)9-19;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | DUGPAOSCPXWIPE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane?
The IUPAC name of 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane (CID 144713865) is 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane.
What is the SMILES notation for 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane?
The canonical SMILES for 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane is CC.Cc1cccc(C)c1-c1cc(C#N)c(F)c(C#N)c1.
What is the InChIKey of 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane?
The InChIKey is DUGPAOSCPXWIPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11FN2.C2H6/c1-10-4-3-5-11(2)15(10)12-6-13(8-18)16(17)14(7-12)9-19;1-2/h3-7H,1-2H3;1-2H3.
What are the key properties of 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane?
5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane has a molecular weight of 280.35 g/mol, XLogP of 4.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-dimethylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane is sourced from PubChem (CID 144713865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).