C25H38N2O3 — CID 144715018
ethane;2-methylheptane;1-oxospiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-7-carboxylic acid (PubChem CID 144715018) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is ethane;2-methylheptane;1-oxospiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-7-carboxylic acid.
| Compound Name | ethane;2-methylheptane;1-oxospiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-7-carboxylic acid |
|---|---|
| PubChem CID | 144715018 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | ethane;2-methylheptane;1-oxospiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-7-carboxylic acid |
| SMILES | CC.CCCCCC(C)C.O=C(O)c1ccc2cc3n(c2c1)C1(CCC1)CNC3=O |
| InChI | InChI=1S/C15H14N2O3.C8H18.C2H6/c18-13-12-6-9-2-3-10(14(19)20)7-11(9)17(12)15(8-16-13)4-1-5-15;1-4-5-6-7-8(2)3;1-2/h2-3,6-7H,1,4-5,8H2,(H,16,18)(H,19,20);8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | MAKOQCYWBTZQMI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|