C29H46N2 — CID 144715356
N,N'-bis(2,3,4,5,6-pentamethylphenyl)-N,N'-dipropylmethanediamine (PubChem CID 144715356) has the molecular formula C29H46N2 and a molecular weight of 422.70 g/mol. Its IUPAC name is N,N'-bis(2,3,4,5,6-pentamethylphenyl)-N,N'-dipropylmethanediamine.
| Compound Name | N,N'-bis(2,3,4,5,6-pentamethylphenyl)-N,N'-dipropylmethanediamine |
|---|---|
| PubChem CID | 144715356 |
| Molecular Formula | C29H46N2 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.37 |
| IUPAC Name | N,N'-bis(2,3,4,5,6-pentamethylphenyl)-N,N'-dipropylmethanediamine |
| SMILES | CCCN(CN(CCC)c1c(C)c(C)c(C)c(C)c1C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C29H46N2/c1-13-15-30(28-24(9)20(5)18(3)21(6)25(28)10)17-31(16-14-2)29-26(11)22(7)19(4)23(8)27(29)12/h13-17H2,1-12H3 |
| InChIKey | GEFBEBIEHJXYBL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|