fluoro 2,5-dihydrofuran-3-carboxylate

C5H5FO3 — CID 144715610

IUPACfluoro 2,5-dihydrofuran-3-carboxylate
SMILESO=C(OF)C1=CCOC1
InChIInChI=1S/C5H5FO3/c6-9-5(7)4-1-2-8-3-4/h1H,2-3H2
InChIKeyYGVWBIUYOWEJPD-UHFFFAOYSA-N
MW132.09 g/mol
LogP0.37
Rot. Bonds1

About fluoro 2,5-dihydrofuran-3-carboxylate

fluoro 2,5-dihydrofuran-3-carboxylate (PubChem CID 144715610) has the molecular formula C5H5FO3 and a molecular weight of 132.09 g/mol. Its IUPAC name is fluoro 2,5-dihydrofuran-3-carboxylate.

Molecular Properties

Compound Namefluoro 2,5-dihydrofuran-3-carboxylate
PubChem CID144715610
Molecular FormulaC5H5FO3
Molecular Weight132.09 g/mol
Exact Mass132.02
IUPAC Namefluoro 2,5-dihydrofuran-3-carboxylate
SMILESO=C(OF)C1=CCOC1
InChIInChI=1S/C5H5FO3/c6-9-5(7)4-1-2-8-3-4/h1H,2-3H2
InChIKeyYGVWBIUYOWEJPD-UHFFFAOYSA-N
XLogP0.37
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.09
LogP ≤ 50.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze fluoro 2,5-dihydrofuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoro 2,5-dihydrofuran-3-carboxylate?
The IUPAC name of fluoro 2,5-dihydrofuran-3-carboxylate (CID 144715610) is fluoro 2,5-dihydrofuran-3-carboxylate.
What is the SMILES notation for fluoro 2,5-dihydrofuran-3-carboxylate?
The canonical SMILES for fluoro 2,5-dihydrofuran-3-carboxylate is O=C(OF)C1=CCOC1.
What is the InChIKey of fluoro 2,5-dihydrofuran-3-carboxylate?
The InChIKey is YGVWBIUYOWEJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FO3/c6-9-5(7)4-1-2-8-3-4/h1H,2-3H2.
What are the key properties of fluoro 2,5-dihydrofuran-3-carboxylate?
fluoro 2,5-dihydrofuran-3-carboxylate has a molecular weight of 132.09 g/mol, XLogP of 0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2,5-dihydrofuran-3-carboxylate is sourced from PubChem (CID 144715610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).