C16H22BrFN2 — CID 144715692
(2S,4R)-2-(5-bromo-2-fluorophenyl)-N,2,5,5,6-pentamethyl-3,4-dihydropyridin-4-amine (PubChem CID 144715692) has the molecular formula C16H22BrFN2 and a molecular weight of 341.27 g/mol. Its IUPAC name is (2S,4R)-2-(5-bromo-2-fluorophenyl)-N,2,5,5,6-pentamethyl-3,4-dihydropyridin-4-amine.
| Compound Name | (2S,4R)-2-(5-bromo-2-fluorophenyl)-N,2,5,5,6-pentamethyl-3,4-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 144715692 |
| Molecular Formula | C16H22BrFN2 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (2S,4R)-2-(5-bromo-2-fluorophenyl)-N,2,5,5,6-pentamethyl-3,4-dihydropyridin-4-amine |
| SMILES | CN[C@@H]1C[C@@](C)(c2cc(Br)ccc2F)N=C(C)C1(C)C |
| InChI | InChI=1S/C16H22BrFN2/c1-10-15(2,3)14(19-5)9-16(4,20-10)12-8-11(17)6-7-13(12)18/h6-8,14,19H,9H2,1-5H3/t14-,16+/m1/s1 |
| InChIKey | YFFIYYIMNBEIFX-ZBFHGGJFSA-N |
| XLogP | 4.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |