About heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine
heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine (PubChem CID 144715728) has the molecular formula C26H57N3O
and a molecular weight of 427.76 g/mol. Its IUPAC name is heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine.
Molecular Properties
| Compound Name | heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine |
| PubChem CID | 144715728 |
| Molecular Formula | C26H57N3O |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.45 |
| IUPAC Name | heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine |
| SMILES | C=C(CCC)NC(C)C.CCCC(=O)NCCNCCC(C)C.CCCCCCC |
| InChI | InChI=1S/C11H24N2O.C8H17N.C7H16/c1-4-5-11(14)13-9-8-12-7-6-10(2)3;1-5-6-8(4)9-7(2)3;1-3-5-7-6-4-2/h10,12H,4-9H2,1-3H3,(H,13,14);7,9H,4-6H2,1-3H3;3-7H2,1-2H3 |
| InChIKey | KVKDSMBUCHHENF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine?
The IUPAC name of heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine (CID 144715728) is heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine.
What is the SMILES notation for heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine?
The canonical SMILES for heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine is C=C(CCC)NC(C)C.CCCC(=O)NCCNCCC(C)C.CCCCCCC.
What is the InChIKey of heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine?
The InChIKey is KVKDSMBUCHHENF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O.C8H17N.C7H16/c1-4-5-11(14)13-9-8-12-7-6-10(2)3;1-5-6-8(4)9-7(2)3;1-3-5-7-6-4-2/h10,12H,4-9H2,1-3H3,(H,13,14);7,9H,4-6H2,1-3H3;3-7H2,1-2H3.
What are the key properties of heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine?
heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine has a molecular weight of 427.76 g/mol, XLogP of 6.81, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;N-[2-(3-methylbutylamino)ethyl]butanamide;N-propan-2-ylpent-1-en-2-amine is sourced from PubChem (CID 144715728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).