About 2,4-dimethyl-1,3-oxazole-5-thiol;ethane
2,4-dimethyl-1,3-oxazole-5-thiol;ethane (PubChem CID 144716045) has the molecular formula C7H13NOS
and a molecular weight of 159.25 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-oxazole-5-thiol;ethane.
Molecular Properties
| Compound Name | 2,4-dimethyl-1,3-oxazole-5-thiol;ethane |
| PubChem CID | 144716045 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2,4-dimethyl-1,3-oxazole-5-thiol;ethane |
| SMILES | CC.Cc1nc(C)c(S)o1 |
| InChI | InChI=1S/C5H7NOS.C2H6/c1-3-5(8)7-4(2)6-3;1-2/h8H,1-2H3;1-2H3 |
| InChIKey | JUDVBLZRFZFMIC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1,3-oxazole-5-thiol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,3-oxazole-5-thiol;ethane?
The IUPAC name of 2,4-dimethyl-1,3-oxazole-5-thiol;ethane (CID 144716045) is 2,4-dimethyl-1,3-oxazole-5-thiol;ethane.
What is the SMILES notation for 2,4-dimethyl-1,3-oxazole-5-thiol;ethane?
The canonical SMILES for 2,4-dimethyl-1,3-oxazole-5-thiol;ethane is CC.Cc1nc(C)c(S)o1.
What is the InChIKey of 2,4-dimethyl-1,3-oxazole-5-thiol;ethane?
The InChIKey is JUDVBLZRFZFMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS.C2H6/c1-3-5(8)7-4(2)6-3;1-2/h8H,1-2H3;1-2H3.
What are the key properties of 2,4-dimethyl-1,3-oxazole-5-thiol;ethane?
2,4-dimethyl-1,3-oxazole-5-thiol;ethane has a molecular weight of 159.25 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,3-oxazole-5-thiol;ethane is sourced from PubChem (CID 144716045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).