About tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen
tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen (PubChem CID 144716239) has the molecular formula C13H22N2O4
and a molecular weight of 270.33 g/mol. Its IUPAC name is tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen.
Molecular Properties
| Compound Name | tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen |
| PubChem CID | 144716239 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen |
| SMILES | CC(C)(C)OC(=O)CCNCCN1C(=O)C=CC1=O.[H][H] |
| InChI | InChI=1S/C13H20N2O4.H2/c1-13(2,3)19-12(18)6-7-14-8-9-15-10(16)4-5-11(15)17;/h4-5,14H,6-9H2,1-3H3;1H |
| InChIKey | ZSSBADJIHDFXRS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen?
The IUPAC name of tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen (CID 144716239) is tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen.
What is the SMILES notation for tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen?
The canonical SMILES for tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen is CC(C)(C)OC(=O)CCNCCN1C(=O)C=CC1=O.[H][H].
What is the InChIKey of tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen?
The InChIKey is ZSSBADJIHDFXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4.H2/c1-13(2,3)19-12(18)6-7-14-8-9-15-10(16)4-5-11(15)17;/h4-5,14H,6-9H2,1-3H3;1H.
What are the key properties of tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen?
tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen has a molecular weight of 270.33 g/mol, XLogP of 0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoate;molecular hydrogen is sourced from PubChem (CID 144716239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).